gradshow24/print/print_style.css

@import "images.css"; 
@import "theatre.css"; 
@import "stephen.css"; 
@import "fairleads.css";

:root {
    --spot-color-1: #2b33c4; 
    --baseline: 4mm;
    --margin-left: 10mm;
}

@font-face {
    font-family: 'Platypi';
    src: url('../fonts/Platypi[wght].woff2');
    font-weight: 300 800;
    font-style: normal;
}

@font-face {
    font-family: 'Platypi';
    src: url('../fonts/Platypi-Italic[wght].woff2');
    font-weight: 300 800;
    font-style: italic;
}
@media print{
    @page{
        size: 130mm 180mm;
        marks: crop; /* can also add cross */
        bleed: 3mm;
        margin: 10mm 25mm 15mm;
        print-color-adjust: exact;

        @bottom-center {
            content: string(title, first);
            position: relative;
            text-align: left;
            font-size: 7pt;
        } 
    }

    @page:left {
        /* bleed: 3mm 0 3mm 3mm; */
        @bottom-left-corner {
            font-size: 7pt;
            position: relative;
            content: counter(page);
            margin-left: 10mm;
    	    text-align: left;
        }
    }

    @page:right {
        margin-top: 10mm;
        margin-bottom: 15mm;
        /* bleed: 3mm 3mm 3mm 0; */
        @bottom-center {
            text-align: right;
        }
        @bottom-right-corner {
            font-size: 7pt;
            position: relative;
            content: counter(page);
            margin-right: 10mm;
	    text-align: right;
        }
    }
}

a {
    text-decoration: none;
    color: #000;
}
.margin-note, .fake-margin-note{
    font-size: 7pt;
    line-height: 3mm;
    display: inline-block;
    text-align-last: initial;
    box-sizing: border-box;
    float: left;
    margin: 5mm 5mm 5mm -15mm;
    color: var(--spot-color-1);
}
body .pagedjs_left_page .margin-note{
    width: 35mm;
}
body .pagedjs_right_page .margin-note{
    width: 35mm;
        float:right;
        margin: 5mm -15mm 5mm 5mm;
}
body .margin-note{
    /* This is overriding position absolute in the plugin, 
    it breaks side notes that are too close to the bottom 
    of the page which is sad */
<<<<<<< HEAD
/*    position: static;*/ 
=======
    position: fixed; 
>>>>>>> 7a53a86b8c437ba4571d5337263eb687f9507a51
}
blockquote .margin-note{
	width: 45mm;
	margin-left: -25mm;
}
.fake-margin-note{
	margin: 20mm 0 0;
	a{color:var(--spot-color-1)};
	h1{font-size: 7pt;}
}
.code pre {
    font-size: 0.8em;
    line-height: 1.1;
    white-space: pre-wrap; 
}
blockquote{
	margin: var(--baseline) 10mm;
	color: var(--spot-color-1);
}
body{
    font-family: 'Platypi',serif ;
    font-synthesis: none;
    line-height: 1.3;
    font-size: 9pt;
    letter-spacing: -0.1px;
    line-height: var(--baseline);
}

h1, h2, h3, h4, h5, h6 {
    font-size: 1.2em;
    line-height: 1;
}

h1 {
    font-size: 3rem;
    font-style: italic;
    break-before: right;
    string-set: title content(text);
}

h2 {
    font-size: 1.6em;
}

.h2-no-pagebreak {
    font-size: 1.6em;
    line-height: 1;
    font-style: italic;
    break-after: avoid;
}


.h1-no-pagebreak {
    font-size: 3rem;
    font-style: italic;
    line-height: 1em;
    font-weight: 700;
    margin-top: 0.5em;
}

.reset-margin-notes{
    counter-reset: markerNote_marginNote -10;
    counter-reset: callNote_marginNote -10;
    display: block;
}

h1#colophon {
    break-before: unset;
    break-after: unset;
    margin-bottom: 25mm;
}
h1#reviews{display: none;}
h2{
	break-before: page;
}
h6 {
    font-size: 3rem;
    break-before: right;
    /* background-color: var(--spot-color-1); */
    /* color: #fff; */
    height: 176mm;
    width: 133mm;
    /* margin: -13mm 0 0 -30mm;
    padding: 86mm 10mm 0; */
    text-align: center;
}

#keylogger{
    color: var(--spot-color-1);
    font-size: 7pt;
    line-height: 3mm;
}
sup{
  color: var(--spot-color-1);
  line-height: 0.1;
  font-size: 7pt;
}
ol, ul {
    padding: 0;
}

.page-break {
    break-after: page;
}

.toc {
    margin: 10mm 0 0 -5mm;
    width: 90mm;
}
.toc h1{
    display: none;
    break-after: none;
}
.toc ul {
    list-style: none;
    padding: 0;
    margin: 0;
    line-height: 6.9mm;
    text-align: center;
}
/* .toc-title:first-of-type, .toc-title:nth-of-type(2), .toc-title:nth-of-type(10){
margin-left: 40mm;
} */
.toc-title{
    font-size: 23pt;
    display: inline;
}

.toc-title a::after {
    content: target-counter(attr(href url), page);
    font-size: 9pt;
    color: var(--spot-color-1);
    padding: 0 0.5rem;
    display: inline-block;
    line-height: 0;
}
#digital-bodies + blockquote{
	margin-right: 0;
}

#bibliography{
    font-size: 7pt;
    line-height: 3mm;

}
#section-4 .bibliography{
	width: 88mm;
}
iframe{
	width: 80mm;
	height: 80mm;
}