You cannot select more than 25 topics
Topics must start with a letter or number, can include dashes ('-') and can be up to 35 characters long.
229 lines
4.2 KiB
CSS
229 lines
4.2 KiB
CSS
@import "images.css";
|
|
@import "theatre.css";
|
|
@import "stephen.css";
|
|
@import "fairleads.css";
|
|
|
|
:root {
|
|
--spot-color-1: #2b33c4;
|
|
--baseline: 4mm;
|
|
--margin-left: 10mm;
|
|
}
|
|
|
|
@font-face {
|
|
font-family: 'Platypi';
|
|
src: url('../fonts/Platypi[wght].woff2');
|
|
font-weight: 300 800;
|
|
font-style: normal;
|
|
}
|
|
|
|
@font-face {
|
|
font-family: 'Platypi';
|
|
src: url('../fonts/Platypi-Italic[wght].woff2');
|
|
font-weight: 300 800;
|
|
font-style: italic;
|
|
}
|
|
@media print{
|
|
@page{
|
|
size: 130mm 180mm;
|
|
marks: crop; /* can also add cross */
|
|
bleed: 3mm;
|
|
margin: 10mm 25mm 15mm;
|
|
print-color-adjust: exact;
|
|
|
|
@bottom-center {
|
|
content: string(title, first);
|
|
position: relative;
|
|
text-align: left;
|
|
font-size: 7pt;
|
|
}
|
|
}
|
|
|
|
@page:left {
|
|
/* bleed: 3mm 0 3mm 3mm; */
|
|
@bottom-left-corner {
|
|
font-size: 7pt;
|
|
position: relative;
|
|
content: counter(page);
|
|
margin-left: 10mm;
|
|
text-align: left;
|
|
}
|
|
}
|
|
|
|
@page:right {
|
|
margin-top: 10mm;
|
|
margin-bottom: 15mm;
|
|
/* bleed: 3mm 3mm 3mm 0; */
|
|
@bottom-center {
|
|
text-align: right;
|
|
}
|
|
@bottom-right-corner {
|
|
font-size: 7pt;
|
|
position: relative;
|
|
content: counter(page);
|
|
margin-right: 10mm;
|
|
text-align: right;
|
|
}
|
|
}
|
|
}
|
|
|
|
a {
|
|
text-decoration: none;
|
|
color: #000;
|
|
}
|
|
.margin-note, .fake-margin-note{
|
|
font-size: 7pt;
|
|
line-height: 3mm;
|
|
display: inline-block;
|
|
text-align-last: initial;
|
|
box-sizing: border-box;
|
|
float: left;
|
|
margin: 5mm 5mm 5mm -15mm;
|
|
color: var(--spot-color-1);
|
|
}
|
|
body .pagedjs_left_page .margin-note{
|
|
width: 35mm;
|
|
}
|
|
body .pagedjs_right_page .margin-note{
|
|
width: 35mm;
|
|
float:right;
|
|
margin: 5mm -15mm 5mm 5mm;
|
|
}
|
|
body .margin-note{
|
|
/* This is overriding position absolute in the plugin,
|
|
it breaks side notes that are too close to the bottom
|
|
of the page which is sad */
|
|
position: static;
|
|
}
|
|
blockquote .margin-note{
|
|
width: 45mm;
|
|
margin-left: -25mm;
|
|
}
|
|
.fake-margin-note{
|
|
margin: 20mm 0 0;
|
|
a{color:var(--spot-color-1)};
|
|
h1{font-size: 7pt;}
|
|
}
|
|
.code pre {
|
|
font-size: 0.8em;
|
|
line-height: 1.1;
|
|
white-space: pre-wrap;
|
|
}
|
|
blockquote{
|
|
margin: var(--baseline) 10mm;
|
|
color: var(--spot-color-1);
|
|
}
|
|
body{
|
|
font-family: 'Platypi',serif ;
|
|
font-synthesis: none;
|
|
line-height: 1.3;
|
|
font-size: 9pt;
|
|
letter-spacing: -0.1px;
|
|
line-height: var(--baseline);
|
|
}
|
|
|
|
h1, h2, h3, h4, h5, h6 {
|
|
font-size: 1.2em;
|
|
line-height: 1;
|
|
}
|
|
|
|
h1 {
|
|
font-size: 3rem;
|
|
font-style: italic;
|
|
break-before: right;
|
|
string-set: title content(text);
|
|
}
|
|
|
|
h2 {
|
|
font-size: 1.6em;
|
|
}
|
|
|
|
.h2-no-pagebreak {
|
|
font-size: 1.6em;
|
|
line-height: 1;
|
|
font-style: italic;
|
|
break-after: avoid;
|
|
}
|
|
|
|
.reset-margin-notes{
|
|
counter-reset: markerNote_marginNote -10;
|
|
counter-reset: callNote_marginNote -10;
|
|
display: block;
|
|
}
|
|
|
|
h1#colophon {
|
|
break-after: unset;
|
|
margin-bottom: 25mm;
|
|
}
|
|
h1#reviews{display: none;}
|
|
h2{
|
|
break-before: page;
|
|
}
|
|
h6 {
|
|
font-size: 3rem;
|
|
break-before: right;
|
|
/* background-color: var(--spot-color-1); */
|
|
/* color: #fff; */
|
|
height: 176mm;
|
|
width: 133mm;
|
|
/* margin: -13mm 0 0 -30mm;
|
|
padding: 86mm 10mm 0; */
|
|
text-align: center;
|
|
}
|
|
|
|
#keylogger{
|
|
color: var(--spot-color-1);
|
|
font-size: 7pt;
|
|
line-height: 3mm;
|
|
}
|
|
sup{
|
|
color: var(--spot-color-1);
|
|
line-height: 0.1;
|
|
font-size: 7pt;
|
|
}
|
|
ol, ul {
|
|
padding: 0;
|
|
}
|
|
|
|
.page-break {
|
|
break-after: page;
|
|
}
|
|
|
|
.toc {
|
|
margin: 10mm 0 0 -5mm;
|
|
width: 90mm;
|
|
}
|
|
.toc h1{
|
|
display: none;
|
|
break-after: none;
|
|
}
|
|
.toc ul {
|
|
list-style: none;
|
|
padding: 0;
|
|
margin: 0;
|
|
line-height: 6.9mm;
|
|
text-align: center;
|
|
}
|
|
/* .toc-title:first-of-type, .toc-title:nth-of-type(2), .toc-title:nth-of-type(10){
|
|
margin-left: 40mm;
|
|
} */
|
|
.toc-title{
|
|
font-size: 23pt;
|
|
display: inline;
|
|
}
|
|
|
|
.toc-title a::after {
|
|
content: target-counter(attr(href url), page);
|
|
font-size: 9pt;
|
|
color: var(--spot-color-1);
|
|
padding: 0 0.5rem;
|
|
display: inline-block;
|
|
line-height: 0;
|
|
}
|
|
#digital-bodies + blockquote{
|
|
margin-right: 0;
|
|
}
|
|
|
|
#bibliography{
|
|
font-size: 6pt;
|
|
}
|