You cannot select more than 25 topics Topics must start with a letter or number, can include dashes ('-') and can be up to 35 characters long.

244 lines
4.4 KiB
CSS

@import "images.css";
@import "theatre.css";
@import "stephen.css";
@import "fairleads.css";
:root {
--spot-color-1: #2b33c4;
--baseline: 4mm;
--margin-left: 10mm;
}
@font-face {
font-family: 'Platypi';
src: url('../fonts/Platypi[wght].woff2');
font-weight: 300 800;
font-style: normal;
}
@font-face {
font-family: 'Platypi';
src: url('../fonts/Platypi-Italic[wght].woff2');
font-weight: 300 800;
font-style: italic;
}
@media print{
@page{
size: 130mm 180mm;
marks: crop; /* can also add cross */
bleed: 3mm;
margin: 10mm 25mm 15mm;
print-color-adjust: exact;
@bottom-center {
content: string(title, first);
position: relative;
text-align: left;
font-size: 7pt;
}
}
@page:left {
/* bleed: 3mm 0 3mm 3mm; */
@bottom-left-corner {
font-size: 7pt;
position: relative;
content: counter(page);
margin-left: 10mm;
text-align: left;
}
}
@page:right {
margin-top: 10mm;
margin-bottom: 15mm;
/* bleed: 3mm 3mm 3mm 0; */
@bottom-center {
text-align: right;
}
@bottom-right-corner {
font-size: 7pt;
position: relative;
content: counter(page);
margin-right: 10mm;
text-align: right;
}
}
}
a {
text-decoration: none;
color: #000;
}
.margin-note, .fake-margin-note{
font-size: 7pt;
line-height: 3mm;
display: inline-block;
text-align-last: initial;
box-sizing: border-box;
float: left;
margin: 5mm 5mm 5mm -15mm;
color: var(--spot-color-1);
}
body .pagedjs_left_page .margin-note{
width: 35mm;
}
body .pagedjs_right_page .margin-note{
width: 35mm;
float:right;
margin: 5mm -15mm 5mm 5mm;
}
body .margin-note{
/* This is overriding position absolute in the plugin,
it breaks side notes that are too close to the bottom
of the page which is sad */
position: static;
}
blockquote .margin-note{
width: 45mm;
margin-left: -25mm;
}
.fake-margin-note{
margin: 20mm 0 0;
a{color:var(--spot-color-1)};
h1{font-size: 7pt;}
}
.code pre {
font-size: 0.8em;
line-height: 1.1;
white-space: pre-wrap;
}
blockquote{
margin: var(--baseline) 10mm;
color: var(--spot-color-1);
}
body{
font-family: 'Platypi',serif ;
font-synthesis: none;
line-height: 1.3;
font-size: 9pt;
letter-spacing: -0.1px;
line-height: var(--baseline);
}
h1, h2, h3, h4, h5, h6 {
font-size: 1.2em;
line-height: 1;
}
h1 {
font-size: 3rem;
font-style: italic;
break-before: right;
string-set: title content(text);
}
h2 {
font-size: 1.6em;
}
.h2-no-pagebreak {
font-size: 1.6em;
line-height: 1;
font-style: italic;
break-after: avoid;
}
.h1-no-pagebreak {
font-size: 3rem;
font-style: italic;
line-height: 1em;
font-weight: 700;
margin-top: 0.5em;
}
.reset-margin-notes{
counter-reset: markerNote_marginNote -10;
counter-reset: callNote_marginNote -10;
display: block;
}
h1#colophon {
break-after: unset;
margin-bottom: 25mm;
}
h1#reviews{display: none;}
h2{
break-before: page;
}
h6 {
font-size: 3rem;
break-before: right;
/* background-color: var(--spot-color-1); */
/* color: #fff; */
height: 176mm;
width: 133mm;
/* margin: -13mm 0 0 -30mm;
padding: 86mm 10mm 0; */
text-align: center;
}
#keylogger{
color: var(--spot-color-1);
font-size: 7pt;
line-height: 3mm;
}
sup{
color: var(--spot-color-1);
line-height: 0.1;
font-size: 7pt;
}
ol, ul {
padding: 0;
}
.page-break {
break-after: page;
}
.toc {
margin: 10mm 0 0 -5mm;
width: 90mm;
}
.toc h1{
display: none;
break-after: none;
}
.toc ul {
list-style: none;
padding: 0;
margin: 0;
line-height: 6.9mm;
text-align: center;
}
/* .toc-title:first-of-type, .toc-title:nth-of-type(2), .toc-title:nth-of-type(10){
margin-left: 40mm;
} */
.toc-title{
font-size: 23pt;
display: inline;
}
.toc-title a::after {
content: target-counter(attr(href url), page);
font-size: 9pt;
color: var(--spot-color-1);
padding: 0 0.5rem;
display: inline-block;
line-height: 0;
}
#digital-bodies + blockquote{
margin-right: 0;
}
#bibliography{
font-size: 7pt;
line-height: 3mm;
}
iframe{
width: 95mm;
height: 95mm;
}